C12H12F2N2O — CID 107137609
5,6-difluoro-1-(oxan-3-yl)benzimidazole (PubChem CID 107137609) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is 5,6-difluoro-1-(oxan-3-yl)benzimidazole.
| Compound Name | 5,6-difluoro-1-(oxan-3-yl)benzimidazole |
|---|---|
| PubChem CID | 107137609 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5,6-difluoro-1-(oxan-3-yl)benzimidazole |
| SMILES | Fc1cc2ncn(C3CCCOC3)c2cc1F |
| InChI | InChI=1S/C12H12F2N2O/c13-9-4-11-12(5-10(9)14)16(7-15-11)8-2-1-3-17-6-8/h4-5,7-8H,1-3,6H2 |
| InChIKey | SIOLSYGNLCCOMD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |