C12H14N2OS — CID 137449431
1-[(3S)-oxan-3-yl]pyrrolo[2,3-b]pyridine-3-thiol (PubChem CID 137449431) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-[(3S)-oxan-3-yl]pyrrolo[2,3-b]pyridine-3-thiol.
| Compound Name | 1-[(3S)-oxan-3-yl]pyrrolo[2,3-b]pyridine-3-thiol |
|---|---|
| PubChem CID | 137449431 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-[(3S)-oxan-3-yl]pyrrolo[2,3-b]pyridine-3-thiol |
| SMILES | Sc1cn([C@H]2CCCOC2)c2ncccc12 |
| InChI | InChI=1S/C12H14N2OS/c16-11-7-14(9-3-2-6-15-8-9)12-10(11)4-1-5-13-12/h1,4-5,7,9,16H,2-3,6,8H2/t9-/m0/s1 |
| InChIKey | GENAJDDXDRGRGT-VIFPVBQESA-N |
| XLogP | 2.68 |
| TPSA | 27.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|