C12H11N3 — CID 67608539
1-cyclobutylpyrrolo[2,3-b]pyridine-3-carbonitrile (PubChem CID 67608539) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-cyclobutylpyrrolo[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 1-cyclobutylpyrrolo[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67608539 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-cyclobutylpyrrolo[2,3-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1cn(C2CCC2)c2ncccc12 |
| InChI | InChI=1S/C12H11N3/c13-7-9-8-15(10-3-1-4-10)12-11(9)5-2-6-14-12/h2,5-6,8,10H,1,3-4H2 |
| InChIKey | PBWMVBJWENJTSB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |