C19H23BN2O2 — CID 141203569
1-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-3-carbonitrile (PubChem CID 141203569) has the molecular formula C19H23BN2O2 and a molecular weight of 322.22 g/mol. Its IUPAC name is 1-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-3-carbonitrile |
|---|---|
| PubChem CID | 141203569 |
| Molecular Formula | C19H23BN2O2 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-3-carbonitrile |
| SMILES | CC1(C)OB(c2ccc3c(C#N)cn(C4CCC4)c3c2)OC1(C)C |
| InChI | InChI=1S/C19H23BN2O2/c1-18(2)19(3,4)24-20(23-18)14-8-9-16-13(11-21)12-22(17(16)10-14)15-6-5-7-15/h8-10,12,15H,5-7H2,1-4H3 |
| InChIKey | ZZGUJJZQPPWUMM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|