C27H26N4O2 — CID 158263039
1-cyclobutyl-6-hydroxyindole-3-carbonitrile;1-cyclobutyl-6-methoxyindole-3-carbonitrile (PubChem CID 158263039) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-cyclobutyl-6-hydroxyindole-3-carbonitrile;1-cyclobutyl-6-methoxyindole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-6-hydroxyindole-3-carbonitrile;1-cyclobutyl-6-methoxyindole-3-carbonitrile |
|---|---|
| PubChem CID | 158263039 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-cyclobutyl-6-hydroxyindole-3-carbonitrile;1-cyclobutyl-6-methoxyindole-3-carbonitrile |
| SMILES | COc1ccc2c(C#N)cn(C3CCC3)c2c1.N#Cc1cn(C2CCC2)c2cc(O)ccc12 |
| InChI | InChI=1S/C14H14N2O.C13H12N2O/c1-17-12-5-6-13-10(8-15)9-16(14(13)7-12)11-3-2-4-11;14-7-9-8-15(10-2-1-3-10)13-6-11(16)4-5-12(9)13/h5-7,9,11H,2-4H2,1H3;4-6,8,10,16H,1-3H2 |
| InChIKey | GICMOYNHVNHOKR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |