C21H20N2O — CID 143511080
1-cyclobutyl-5-methoxy-2-(4-methylphenyl)indole-3-carbonitrile (PubChem CID 143511080) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-cyclobutyl-5-methoxy-2-(4-methylphenyl)indole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-5-methoxy-2-(4-methylphenyl)indole-3-carbonitrile |
|---|---|
| PubChem CID | 143511080 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-cyclobutyl-5-methoxy-2-(4-methylphenyl)indole-3-carbonitrile |
| SMILES | COc1ccc2c(c1)c(C#N)c(-c1ccc(C)cc1)n2C1CCC1 |
| InChI | InChI=1S/C21H20N2O/c1-14-6-8-15(9-7-14)21-19(13-22)18-12-17(24-2)10-11-20(18)23(21)16-4-3-5-16/h6-12,16H,3-5H2,1-2H3 |
| InChIKey | MUPRHWKZDKLWEF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |