C24H25N3O4 — CID 59425022
methyl N-[4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate (PubChem CID 59425022) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl N-[4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59425022 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | methyl N-[4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamate |
| SMILES | COCCOc1ccc2c(C#N)c(-c3ccc(NC(=O)OC)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C24H25N3O4/c1-29-12-13-31-19-10-11-20-21(15-25)23(27(22(20)14-19)18-4-3-5-18)16-6-8-17(9-7-16)26-24(28)30-2/h6-11,14,18H,3-5,12-13H2,1-2H3,(H,26,28) |
| InChIKey | GYOJZEBUALIHQP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|