C26H30N4O3 — CID 59425011
1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(1-methoxypropan-2-yl)urea (PubChem CID 59425011) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(1-methoxypropan-2-yl)urea.
| Compound Name | 1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(1-methoxypropan-2-yl)urea |
|---|---|
| PubChem CID | 59425011 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(1-methoxypropan-2-yl)urea |
| SMILES | CCOc1ccc2c(C#N)c(-c3ccc(NC(=O)NC(C)COC)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C26H30N4O3/c1-4-33-21-12-13-22-23(15-27)25(30(24(22)14-21)20-6-5-7-20)18-8-10-19(11-9-18)29-26(31)28-17(2)16-32-3/h8-14,17,20H,4-7,16H2,1-3H3,(H2,28,29,31) |
| InChIKey | YMIGZEVTCPZATO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |