C28H33N5O3 — CID 59425775
1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 59425775) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 59425775 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | CCOc1ccc2c(C#N)c(-c3ccc(NC(=O)NCCN4CCOCC4)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C28H33N5O3/c1-2-36-23-10-11-24-25(19-29)27(33(26(24)18-23)22-4-3-5-22)20-6-8-21(9-7-20)31-28(34)30-12-13-32-14-16-35-17-15-32/h6-11,18,22H,2-5,12-17H2,1H3,(H2,30,31,34) |
| InChIKey | FCTCILDIXNWNEO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |