C23H23N3O4 — CID 59426144
[4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamic acid (PubChem CID 59426144) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is [4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamic acid.
| Compound Name | [4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 59426144 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [4-[3-cyano-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]phenyl]carbamic acid |
| SMILES | COCCOc1ccc2c(C#N)c(-c3ccc(NC(=O)O)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C23H23N3O4/c1-29-11-12-30-18-9-10-19-20(14-24)22(26(21(19)13-18)17-3-2-4-17)15-5-7-16(8-6-15)25-23(27)28/h5-10,13,17,25H,2-4,11-12H2,1H3,(H,27,28) |
| InChIKey | HQJMNPGAOFKPST-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|