C27H28F3N3O4 — CID 59425311
1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-6-(2-ethoxyethoxy)indol-2-yl]phenyl]carbamate (PubChem CID 59425311) has the molecular formula C27H28F3N3O4 and a molecular weight of 515.53 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-6-(2-ethoxyethoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | 1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-6-(2-ethoxyethoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59425311 |
| Molecular Formula | C27H28F3N3O4 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-6-(2-ethoxyethoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CCOCCOc1ccc2c(C#N)c(-c3ccc(NC(=O)OC(C)C(F)(F)F)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C27H28F3N3O4/c1-3-35-13-14-36-21-11-12-22-23(16-31)25(33(24(22)15-21)20-5-4-6-20)18-7-9-19(10-8-18)32-26(34)37-17(2)27(28,29)30/h7-12,15,17,20H,3-6,13-14H2,1-2H3,(H,32,34) |
| InChIKey | MMBPMYMUPWMHED-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|