C29H28F3N5O3 — CID 59426336
1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-5-(3-imidazol-1-ylpropoxy)indol-2-yl]phenyl]carbamate (PubChem CID 59426336) has the molecular formula C29H28F3N5O3 and a molecular weight of 551.57 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-5-(3-imidazol-1-ylpropoxy)indol-2-yl]phenyl]carbamate.
| Compound Name | 1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-5-(3-imidazol-1-ylpropoxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59426336 |
| Molecular Formula | C29H28F3N5O3 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl N-[4-[3-cyano-1-cyclobutyl-5-(3-imidazol-1-ylpropoxy)indol-2-yl]phenyl]carbamate |
| SMILES | CC(OC(=O)Nc1ccc(-c2c(C#N)c3cc(OCCCn4ccnc4)ccc3n2C2CCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H28F3N5O3/c1-19(29(30,31)32)40-28(38)35-21-8-6-20(7-9-21)27-25(17-33)24-16-23(39-15-3-13-36-14-12-34-18-36)10-11-26(24)37(27)22-4-2-5-22/h6-12,14,16,18-19,22H,2-5,13,15H2,1H3,(H,35,38) |
| InChIKey | CHNNGJBRAHEDPR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|