C28H31N7O2 — CID 25052173
1-[4-[3-cyano-1-cyclobutyl-6-[3-(1,2,4-triazol-1-yl)propoxy]indol-2-yl]phenyl]-3-propan-2-ylurea (PubChem CID 25052173) has the molecular formula C28H31N7O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 1-[4-[3-cyano-1-cyclobutyl-6-[3-(1,2,4-triazol-1-yl)propoxy]indol-2-yl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[3-cyano-1-cyclobutyl-6-[3-(1,2,4-triazol-1-yl)propoxy]indol-2-yl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 25052173 |
| Molecular Formula | C28H31N7O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 1-[4-[3-cyano-1-cyclobutyl-6-[3-(1,2,4-triazol-1-yl)propoxy]indol-2-yl]phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc(-c2c(C#N)c3ccc(OCCCn4cncn4)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C28H31N7O2/c1-19(2)32-28(36)33-21-9-7-20(8-10-21)27-25(16-29)24-12-11-23(15-26(24)35(27)22-5-3-6-22)37-14-4-13-34-18-30-17-31-34/h7-12,15,17-19,22H,3-6,13-14H2,1-2H3,(H2,32,33,36) |
| InChIKey | XOJQTMSUKLZGOJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|