C26H27ClN2O3 — CID 89344417
propan-2-yl N-[4-[5-(2-chloroethoxy)-1-cyclobutyl-3-ethynylindol-2-yl]phenyl]carbamate (PubChem CID 89344417) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is propan-2-yl N-[4-[5-(2-chloroethoxy)-1-cyclobutyl-3-ethynylindol-2-yl]phenyl]carbamate.
| Compound Name | propan-2-yl N-[4-[5-(2-chloroethoxy)-1-cyclobutyl-3-ethynylindol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 89344417 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | propan-2-yl N-[4-[5-(2-chloroethoxy)-1-cyclobutyl-3-ethynylindol-2-yl]phenyl]carbamate |
| SMILES | C#Cc1c(-c2ccc(NC(=O)OC(C)C)cc2)n(C2CCC2)c2ccc(OCCCl)cc12 |
| InChI | InChI=1S/C26H27ClN2O3/c1-4-22-23-16-21(31-15-14-27)12-13-24(23)29(20-6-5-7-20)25(22)18-8-10-19(11-9-18)28-26(30)32-17(2)3/h1,8-13,16-17,20H,5-7,14-15H2,2-3H3,(H,28,30) |
| InChIKey | RZMLIYHNNPHCNH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|