C27H32N6O3 — CID 143509789
propan-2-yl N-[4-[6-[3-[(2Z)-2-(aminomethylidene)hydrazinyl]propoxy]-3-cyano-1-cyclobutylindol-2-yl]phenyl]carbamate (PubChem CID 143509789) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is propan-2-yl N-[4-[6-[3-[(2Z)-2-(aminomethylidene)hydrazinyl]propoxy]-3-cyano-1-cyclobutylindol-2-yl]phenyl]carbamate.
| Compound Name | propan-2-yl N-[4-[6-[3-[(2Z)-2-(aminomethylidene)hydrazinyl]propoxy]-3-cyano-1-cyclobutylindol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 143509789 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | propan-2-yl N-[4-[6-[3-[(2Z)-2-(aminomethylidene)hydrazinyl]propoxy]-3-cyano-1-cyclobutylindol-2-yl]phenyl]carbamate |
| SMILES | CC(C)OC(=O)Nc1ccc(-c2c(C#N)c3ccc(OCCCN/N=C\N)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C27H32N6O3/c1-18(2)36-27(34)32-20-9-7-19(8-10-20)26-24(16-28)23-12-11-22(35-14-4-13-30-31-17-29)15-25(23)33(26)21-5-3-6-21/h7-12,15,17-18,21,30H,3-6,13-14H2,1-2H3,(H2,29,31)(H,32,34) |
| InChIKey | ZOKHLHVSVXVWQK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|