C22H22N2O2 — CID 91127779
1-cyclobutyl-6-(2-methoxyethoxy)-2-phenylindole-3-carbonitrile (PubChem CID 91127779) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-cyclobutyl-6-(2-methoxyethoxy)-2-phenylindole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-6-(2-methoxyethoxy)-2-phenylindole-3-carbonitrile |
|---|---|
| PubChem CID | 91127779 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-cyclobutyl-6-(2-methoxyethoxy)-2-phenylindole-3-carbonitrile |
| SMILES | COCCOc1ccc2c(C#N)c(-c3ccccc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C22H22N2O2/c1-25-12-13-26-18-10-11-19-20(15-23)22(16-6-3-2-4-7-16)24(21(19)14-18)17-8-5-9-17/h2-4,6-7,10-11,14,17H,5,8-9,12-13H2,1H3 |
| InChIKey | ZZSRFZJDEMKGPP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|