C26H25N5OS — CID 143509280
1-cyclobutyl-2-[4-(methylamino)phenyl]-6-(2-pyrimidin-2-ylsulfanylethoxy)indole-3-carbonitrile (PubChem CID 143509280) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is 1-cyclobutyl-2-[4-(methylamino)phenyl]-6-(2-pyrimidin-2-ylsulfanylethoxy)indole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-2-[4-(methylamino)phenyl]-6-(2-pyrimidin-2-ylsulfanylethoxy)indole-3-carbonitrile |
|---|---|
| PubChem CID | 143509280 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 1-cyclobutyl-2-[4-(methylamino)phenyl]-6-(2-pyrimidin-2-ylsulfanylethoxy)indole-3-carbonitrile |
| SMILES | CNc1ccc(-c2c(C#N)c3ccc(OCCSc4ncccn4)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C26H25N5OS/c1-28-19-8-6-18(7-9-19)25-23(17-27)22-11-10-21(16-24(22)31(25)20-4-2-5-20)32-14-15-33-26-29-12-3-13-30-26/h3,6-13,16,20,28H,2,4-5,14-15H2,1H3 |
| InChIKey | MHCHQGJCEULIIA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|