C28H31N5O2 — CID 88979339
1-cyclobutyl-6-(1,3-oxazol-4-ylmethoxy)-2-[4-[1-(propan-2-ylamino)ethylamino]phenyl]indole-3-carbonitrile (PubChem CID 88979339) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 1-cyclobutyl-6-(1,3-oxazol-4-ylmethoxy)-2-[4-[1-(propan-2-ylamino)ethylamino]phenyl]indole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-6-(1,3-oxazol-4-ylmethoxy)-2-[4-[1-(propan-2-ylamino)ethylamino]phenyl]indole-3-carbonitrile |
|---|---|
| PubChem CID | 88979339 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 1-cyclobutyl-6-(1,3-oxazol-4-ylmethoxy)-2-[4-[1-(propan-2-ylamino)ethylamino]phenyl]indole-3-carbonitrile |
| SMILES | CC(C)NC(C)Nc1ccc(-c2c(C#N)c3ccc(OCc4cocn4)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C28H31N5O2/c1-18(2)31-19(3)32-21-9-7-20(8-10-21)28-26(14-29)25-12-11-24(35-16-22-15-34-17-30-22)13-27(25)33(28)23-5-4-6-23/h7-13,15,17-19,23,31-32H,4-6,16H2,1-3H3 |
| InChIKey | MSIZXCJXGCHKAX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|