C22H23N3O3S — CID 58694386
N-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]methanesulfonamide (PubChem CID 58694386) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 58694386 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[4-(3-cyano-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]methanesulfonamide |
| SMILES | CCOc1ccc2c(C#N)c(-c3ccc(NS(C)(=O)=O)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-3-28-18-11-12-19-20(14-23)22(25(21(19)13-18)17-5-4-6-17)15-7-9-16(10-8-15)24-29(2,26)27/h7-13,17,24H,3-6H2,1-2H3 |
| InChIKey | XXWWWMMVCUWFGR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |