C25H30N3O4P — CID 59430508
1-cyclobutyl-2-[4-(diethoxyphosphorylamino)phenyl]-5-ethoxyindole-3-carbonitrile (PubChem CID 59430508) has the molecular formula C25H30N3O4P and a molecular weight of 467.51 g/mol. Its IUPAC name is 1-cyclobutyl-2-[4-(diethoxyphosphorylamino)phenyl]-5-ethoxyindole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-2-[4-(diethoxyphosphorylamino)phenyl]-5-ethoxyindole-3-carbonitrile |
|---|---|
| PubChem CID | 59430508 |
| Molecular Formula | C25H30N3O4P |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 1-cyclobutyl-2-[4-(diethoxyphosphorylamino)phenyl]-5-ethoxyindole-3-carbonitrile |
| SMILES | CCOc1ccc2c(c1)c(C#N)c(-c1ccc(NP(=O)(OCC)OCC)cc1)n2C1CCC1 |
| InChI | InChI=1S/C25H30N3O4P/c1-4-30-21-14-15-24-22(16-21)23(17-26)25(28(24)20-8-7-9-20)18-10-12-19(13-11-18)27-33(29,31-5-2)32-6-3/h10-16,20H,4-9H2,1-3H3,(H,27,29) |
| InChIKey | KYZMKXFFQBIHJO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|