C28H37N3O3 — CID 143510951
2-(4-aminophenyl)-1-cyclopentyl-6-ethoxyindole-3-carbonitrile;ethane;propyl formate (PubChem CID 143510951) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-cyclopentyl-6-ethoxyindole-3-carbonitrile;ethane;propyl formate.
| Compound Name | 2-(4-aminophenyl)-1-cyclopentyl-6-ethoxyindole-3-carbonitrile;ethane;propyl formate |
|---|---|
| PubChem CID | 143510951 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | 2-(4-aminophenyl)-1-cyclopentyl-6-ethoxyindole-3-carbonitrile;ethane;propyl formate |
| SMILES | CC.CCCOC=O.CCOc1ccc2c(C#N)c(-c3ccc(N)cc3)n(C3CCCC3)c2c1 |
| InChI | InChI=1S/C22H23N3O.C4H8O2.C2H6/c1-2-26-18-11-12-19-20(14-23)22(15-7-9-16(24)10-8-15)25(21(19)13-18)17-5-3-4-6-17;1-2-3-6-4-5;1-2/h7-13,17H,2-6,24H2,1H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | ZMTLCEPIVAFACE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|