C20H23N3O — CID 89344162
2-(4-aminophenyl)-1-cyclobutyl-5-ethoxyindol-3-amine (PubChem CID 89344162) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-cyclobutyl-5-ethoxyindol-3-amine.
| Compound Name | 2-(4-aminophenyl)-1-cyclobutyl-5-ethoxyindol-3-amine |
|---|---|
| PubChem CID | 89344162 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-(4-aminophenyl)-1-cyclobutyl-5-ethoxyindol-3-amine |
| SMILES | CCOc1ccc2c(c1)c(N)c(-c1ccc(N)cc1)n2C1CCC1 |
| InChI | InChI=1S/C20H23N3O/c1-2-24-16-10-11-18-17(12-16)19(22)20(23(18)15-4-3-5-15)13-6-8-14(21)9-7-13/h6-12,15H,2-5,21-22H2,1H3 |
| InChIKey | KPPZCNMKCHVPSW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|