C24H29N3O3 — CID 70844575
2-methylpropyl N-[4-(3-amino-1-cyclobutyl-5-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 70844575) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-methylpropyl N-[4-(3-amino-1-cyclobutyl-5-methoxyindol-2-yl)phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[4-(3-amino-1-cyclobutyl-5-methoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70844575 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-methylpropyl N-[4-(3-amino-1-cyclobutyl-5-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | COc1ccc2c(c1)c(N)c(-c1ccc(NC(=O)OCC(C)C)cc1)n2C1CCC1 |
| InChI | InChI=1S/C24H29N3O3/c1-15(2)14-30-24(28)26-17-9-7-16(8-10-17)23-22(25)20-13-19(29-3)11-12-21(20)27(23)18-5-4-6-18/h7-13,15,18H,4-6,14,25H2,1-3H3,(H,26,28) |
| InChIKey | CCNRXYAESMMLCX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |