C25H29N3O4 — CID 70805428
oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate (PubChem CID 70805428) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate.
| Compound Name | oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70805428 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCOc1ccc2c(N)c(-c3ccc(NC(=O)OC4CCOC4)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C25H29N3O4/c1-2-31-19-10-11-21-22(14-19)28(18-4-3-5-18)24(23(21)26)16-6-8-17(9-7-16)27-25(29)32-20-12-13-30-15-20/h6-11,14,18,20H,2-5,12-13,15,26H2,1H3,(H,27,29) |
| InChIKey | DSLJEXVKMIEZST-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |