About oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate
oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate (PubChem CID 70805428) has the molecular formula C25H29N3O4
and a molecular weight of 435.52 g/mol. Its IUPAC name is oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate |
| PubChem CID | 70805428 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCOc1ccc2c(N)c(-c3ccc(NC(=O)OC4CCOC4)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C25H29N3O4/c1-2-31-19-10-11-21-22(14-19)28(18-4-3-5-18)24(23(21)26)16-6-8-17(9-7-16)27-25(29)32-20-12-13-30-15-20/h6-11,14,18,20H,2-5,12-13,15,26H2,1H3,(H,27,29) |
| InChIKey | DSLJEXVKMIEZST-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate?
The IUPAC name of oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate (CID 70805428) is oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate.
What is the SMILES notation for oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate?
The canonical SMILES for oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate is CCOc1ccc2c(N)c(-c3ccc(NC(=O)OC4CCOC4)cc3)n(C3CCC3)c2c1.
What is the InChIKey of oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate?
The InChIKey is DSLJEXVKMIEZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O4/c1-2-31-19-10-11-21-22(14-19)28(18-4-3-5-18)24(23(21)26)16-6-8-17(9-7-16)27-25(29)32-20-12-13-30-15-20/h6-11,14,18,20H,2-5,12-13,15,26H2,1H3,(H,27,29).
What are the key properties of oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate?
oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate has a molecular weight of 435.52 g/mol, XLogP of 5.35, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl N-[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]carbamate is sourced from PubChem (CID 70805428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).