C25H29N3O3 — CID 71176585
[4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 71176585) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 71176585 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [4-(3-amino-1-cyclobutyl-6-ethoxyindol-2-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | CCOc1ccc2c(N)c(-c3ccc(C(=O)N4CCOCC4)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-31-20-10-11-21-22(16-20)28(19-4-3-5-19)24(23(21)26)17-6-8-18(9-7-17)25(29)27-12-14-30-15-13-27/h6-11,16,19H,2-5,12-15,26H2,1H3 |
| InChIKey | AALLROHSDCPTAG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |