C25H29N3O3 — CID 70825684
4-[3-amino-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]-N-cyclopropylbenzamide (PubChem CID 70825684) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[3-amino-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]-N-cyclopropylbenzamide.
| Compound Name | 4-[3-amino-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 70825684 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-[3-amino-1-cyclobutyl-6-(2-methoxyethoxy)indol-2-yl]-N-cyclopropylbenzamide |
| SMILES | COCCOc1ccc2c(N)c(-c3ccc(C(=O)NC4CC4)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C25H29N3O3/c1-30-13-14-31-20-11-12-21-22(15-20)28(19-3-2-4-19)24(23(21)26)16-5-7-17(8-6-16)25(29)27-18-9-10-18/h5-8,11-12,15,18-19H,2-4,9-10,13-14,26H2,1H3,(H,27,29) |
| InChIKey | DTRIECNPNAWDCX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|