C20H22N2O — CID 141210533
4-(1-cyclobutyl-6-ethoxyindol-2-yl)aniline (PubChem CID 141210533) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(1-cyclobutyl-6-ethoxyindol-2-yl)aniline.
| Compound Name | 4-(1-cyclobutyl-6-ethoxyindol-2-yl)aniline |
|---|---|
| PubChem CID | 141210533 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-(1-cyclobutyl-6-ethoxyindol-2-yl)aniline |
| SMILES | CCOc1ccc2cc(-c3ccc(N)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C20H22N2O/c1-2-23-18-11-8-15-12-19(14-6-9-16(21)10-7-14)22(20(15)13-18)17-4-3-5-17/h6-13,17H,2-5,21H2,1H3 |
| InChIKey | VECXXOGTNYNVGZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|