C30H38N3O4P — CID 143509716
1-cyclobutyl-6-(2-dimethylphosphanyloxyethoxy)-2-[4-(methylamino)phenyl]indole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate (PubChem CID 143509716) has the molecular formula C30H38N3O4P and a molecular weight of 535.63 g/mol. Its IUPAC name is 1-cyclobutyl-6-(2-dimethylphosphanyloxyethoxy)-2-[4-(methylamino)phenyl]indole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate.
| Compound Name | 1-cyclobutyl-6-(2-dimethylphosphanyloxyethoxy)-2-[4-(methylamino)phenyl]indole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate |
|---|---|
| PubChem CID | 143509716 |
| Molecular Formula | C30H38N3O4P |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 1-cyclobutyl-6-(2-dimethylphosphanyloxyethoxy)-2-[4-(methylamino)phenyl]indole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate |
| SMILES | CNc1ccc(-c2c(C#N)c3ccc(OCCOP(C)C)cc3n2C2CCC2)cc1.C[C@@H](OC=O)C1CC1 |
| InChI | InChI=1S/C24H28N3O2P.C6H10O2/c1-26-18-9-7-17(8-10-18)24-22(16-25)21-12-11-20(28-13-14-29-30(2)3)15-23(21)27(24)19-5-4-6-19;1-5(8-4-7)6-2-3-6/h7-12,15,19,26H,4-6,13-14H2,1-3H3;4-6H,2-3H2,1H3/t;5-/m.1/s1 |
| InChIKey | PCLTVKSFNYHXTM-QDXATWJZSA-N |
| XLogP | 6.96 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|