C26H28N4O3 — CID 59426368
1-[4-(3-cyano-1-cyclopropyl-6-ethoxyindol-2-yl)phenyl]-3-(oxan-4-yl)urea (PubChem CID 59426368) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[4-(3-cyano-1-cyclopropyl-6-ethoxyindol-2-yl)phenyl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[4-(3-cyano-1-cyclopropyl-6-ethoxyindol-2-yl)phenyl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 59426368 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-[4-(3-cyano-1-cyclopropyl-6-ethoxyindol-2-yl)phenyl]-3-(oxan-4-yl)urea |
| SMILES | CCOc1ccc2c(C#N)c(-c3ccc(NC(=O)NC4CCOCC4)cc3)n(C3CC3)c2c1 |
| InChI | InChI=1S/C26H28N4O3/c1-2-33-21-9-10-22-23(16-27)25(30(20-7-8-20)24(22)15-21)17-3-5-18(6-4-17)28-26(31)29-19-11-13-32-14-12-19/h3-6,9-10,15,19-20H,2,7-8,11-14H2,1H3,(H2,28,29,31) |
| InChIKey | ZHRLNSANSMJASE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |