C25H28IN3O2 — CID 59425780
1-cyclobutyl-3-[4-(1-cyclobutyl-6-ethoxy-3-iodoindol-2-yl)phenyl]urea (PubChem CID 59425780) has the molecular formula C25H28IN3O2 and a molecular weight of 529.42 g/mol. Its IUPAC name is 1-cyclobutyl-3-[4-(1-cyclobutyl-6-ethoxy-3-iodoindol-2-yl)phenyl]urea.
| Compound Name | 1-cyclobutyl-3-[4-(1-cyclobutyl-6-ethoxy-3-iodoindol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 59425780 |
| Molecular Formula | C25H28IN3O2 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 1-cyclobutyl-3-[4-(1-cyclobutyl-6-ethoxy-3-iodoindol-2-yl)phenyl]urea |
| SMILES | CCOc1ccc2c(I)c(-c3ccc(NC(=O)NC4CCC4)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C25H28IN3O2/c1-2-31-20-13-14-21-22(15-20)29(19-7-4-8-19)24(23(21)26)16-9-11-18(12-10-16)28-25(30)27-17-5-3-6-17/h9-15,17,19H,2-8H2,1H3,(H2,27,28,30) |
| InChIKey | MDFISYWCOBKBSF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|