C28H33N5O3 — CID 91436088
ethanimidoyl 1-cyclobutyl-2-[4-(cyclobutylcarbamoylamino)phenyl]-6-ethoxyindole-3-carboximidate (PubChem CID 91436088) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is ethanimidoyl 1-cyclobutyl-2-[4-(cyclobutylcarbamoylamino)phenyl]-6-ethoxyindole-3-carboximidate.
| Compound Name | ethanimidoyl 1-cyclobutyl-2-[4-(cyclobutylcarbamoylamino)phenyl]-6-ethoxyindole-3-carboximidate |
|---|---|
| PubChem CID | 91436088 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | ethanimidoyl 1-cyclobutyl-2-[4-(cyclobutylcarbamoylamino)phenyl]-6-ethoxyindole-3-carboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1c(-c2ccc(NC(=O)NC3CCC3)cc2)n(C2CCC2)c2cc(OCC)ccc12 |
| InChI | InChI=1S/C28H33N5O3/c1-3-35-22-14-15-23-24(16-22)33(21-8-5-9-21)26(25(23)27(30)36-17(2)29)18-10-12-20(13-11-18)32-28(34)31-19-6-4-7-19/h10-16,19,21,29-30H,3-9H2,1-2H3,(H2,31,32,34)/b29-17+,30-27- |
| InChIKey | RBFZFDCDXIIWDM-RMUWJMETSA-N |
| XLogP | 6.45 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|