C30H35N3O4 — CID 59425514
1-[4-[3-acetyl-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea (PubChem CID 59425514) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 1-[4-[3-acetyl-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea.
| Compound Name | 1-[4-[3-acetyl-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea |
|---|---|
| PubChem CID | 59425514 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 1-[4-[3-acetyl-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea |
| SMILES | CC(=O)c1c(-c2ccc(NC(=O)NC3CCC3)cc2)n(C2CCC2)c2cc(OC3CCOCC3)ccc12 |
| InChI | InChI=1S/C30H35N3O4/c1-19(34)28-26-13-12-25(37-24-14-16-36-17-15-24)18-27(26)33(23-6-3-7-23)29(28)20-8-10-22(11-9-20)32-30(35)31-21-4-2-5-21/h8-13,18,21,23-24H,2-7,14-17H2,1H3,(H2,31,32,35) |
| InChIKey | XMJLQLWGUHCRKS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |