C28H32ClN3O3 — CID 59425421
1-[4-[3-chloro-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea (PubChem CID 59425421) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is 1-[4-[3-chloro-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea.
| Compound Name | 1-[4-[3-chloro-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea |
|---|---|
| PubChem CID | 59425421 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 1-[4-[3-chloro-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]-3-cyclobutylurea |
| SMILES | O=C(Nc1ccc(-c2c(Cl)c3ccc(OC4CCOCC4)cc3n2C2CCC2)cc1)NC1CCC1 |
| InChI | InChI=1S/C28H32ClN3O3/c29-26-24-12-11-23(35-22-13-15-34-16-14-22)17-25(24)32(21-5-2-6-21)27(26)18-7-9-20(10-8-18)31-28(33)30-19-3-1-4-19/h7-12,17,19,21-22H,1-6,13-16H2,(H2,30,31,33) |
| InChIKey | HZHRSVGPASFABV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |