C17H24N4O — CID 117161793
3-(1-methylpiperidin-4-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117161793) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-(1-methylpiperidin-4-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(1-methylpiperidin-4-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117161793 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 3-(1-methylpiperidin-4-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine |
| SMILES | CN1CCC(n2c(C3CCCOC3)nc3cccnc32)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-20-9-6-14(7-10-20)21-16(13-4-3-11-22-12-13)19-15-5-2-8-18-17(15)21/h2,5,8,13-14H,3-4,6-7,9-12H2,1H3 |
| InChIKey | ASBGJHITTQSEFK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |