C17H23N3O2 — CID 117161927
2-(oxan-3-yl)-3-(oxan-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117161927) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(oxan-3-yl)-3-(oxan-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(oxan-3-yl)-3-(oxan-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117161927 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-(oxan-3-yl)-3-(oxan-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(C1CCCOC1)n2CC1CCCCO1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-10-22-14(6-1)11-20-16(13-5-4-9-21-12-13)19-15-7-3-8-18-17(15)20/h3,7-8,13-14H,1-2,4-6,9-12H2 |
| InChIKey | OKGGUAFMVDZDKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |