C18H25N3O2 — CID 117161600
3-(oxan-2-ylmethyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117161600) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-(oxan-2-ylmethyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(oxan-2-ylmethyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117161600 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3-(oxan-2-ylmethyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(CC1CCOCC1)n2CC1CCCCO1 |
| InChI | InChI=1S/C18H25N3O2/c1-2-9-23-15(4-1)13-21-17(12-14-6-10-22-11-7-14)20-16-5-3-8-19-18(16)21/h3,5,8,14-15H,1-2,4,6-7,9-13H2 |
| InChIKey | KKTQADVVIUBTOK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |