C15H21N3O2 — CID 117161472
3-[2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propan-1-ol (PubChem CID 117161472) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propan-1-ol.
| Compound Name | 3-[2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 117161472 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-[2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propan-1-ol |
| SMILES | OCCCn1c(CC2CCOCC2)nc2cccnc21 |
| InChI | InChI=1S/C15H21N3O2/c19-8-2-7-18-14(11-12-4-9-20-10-5-12)17-13-3-1-6-16-15(13)18/h1,3,6,12,19H,2,4-5,7-11H2 |
| InChIKey | XNPQYAVNGXSNIF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |