C18H18FN3O — CID 117161697
3-(4-fluorophenyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117161697) has the molecular formula C18H18FN3O and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(4-fluorophenyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117161697 |
| Molecular Formula | C18H18FN3O |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-(4-fluorophenyl)-2-(oxan-4-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | Fc1ccc(-n2c(CC3CCOCC3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C18H18FN3O/c19-14-3-5-15(6-4-14)22-17(12-13-7-10-23-11-8-13)21-16-2-1-9-20-18(16)22/h1-6,9,13H,7-8,10-12H2 |
| InChIKey | MBTTWGGEEGZDFL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |