C15H21N3O2 — CID 117159635
2-(3-methoxypropyl)-3-(oxolan-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117159635) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-3-(oxolan-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(3-methoxypropyl)-3-(oxolan-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117159635 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-(3-methoxypropyl)-3-(oxolan-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | COCCCc1nc2cccnc2n1CC1CCCO1 |
| InChI | InChI=1S/C15H21N3O2/c1-19-9-4-7-14-17-13-6-2-8-16-15(13)18(14)11-12-5-3-10-20-12/h2,6,8,12H,3-5,7,9-11H2,1H3 |
| InChIKey | QNPOOVAIKXLRBI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|