C17H18ClN3O — CID 117159702
3-[(2-chlorophenyl)methyl]-2-(3-methoxypropyl)imidazo[4,5-b]pyridine (PubChem CID 117159702) has the molecular formula C17H18ClN3O and a molecular weight of 315.80 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2-(3-methoxypropyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2-(3-methoxypropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117159702 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2-(3-methoxypropyl)imidazo[4,5-b]pyridine |
| SMILES | COCCCc1nc2cccnc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3O/c1-22-11-5-9-16-20-15-8-4-10-19-17(15)21(16)12-13-6-2-3-7-14(13)18/h2-4,6-8,10H,5,9,11-12H2,1H3 |
| InChIKey | RZFPBWJRKYRWET-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|