C17H24N4O — CID 117162925
3-(oxan-2-ylmethyl)-2-piperidin-2-ylimidazo[4,5-b]pyridine (PubChem CID 117162925) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-(oxan-2-ylmethyl)-2-piperidin-2-ylimidazo[4,5-b]pyridine.
| Compound Name | 3-(oxan-2-ylmethyl)-2-piperidin-2-ylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117162925 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 3-(oxan-2-ylmethyl)-2-piperidin-2-ylimidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(C1CCCCN1)n2CC1CCCCO1 |
| InChI | InChI=1S/C17H24N4O/c1-3-9-18-14(7-1)17-20-15-8-5-10-19-16(15)21(17)12-13-6-2-4-11-22-13/h5,8,10,13-14,18H,1-4,6-7,9,11-12H2 |
| InChIKey | FNMISVAYVMBXIK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |