C15H14ClN3O2 — CID 117161953
3-(5-chlorofuran-2-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117161953) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 3-(5-chlorofuran-2-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(5-chlorofuran-2-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117161953 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-(5-chlorofuran-2-yl)-2-(oxan-3-yl)imidazo[4,5-b]pyridine |
| SMILES | Clc1ccc(-n2c(C3CCCOC3)nc3cccnc32)o1 |
| InChI | InChI=1S/C15H14ClN3O2/c16-12-5-6-13(21-12)19-14(10-3-2-8-20-9-10)18-11-4-1-7-17-15(11)19/h1,4-7,10H,2-3,8-9H2 |
| InChIKey | BNMIJYJYFAEWNA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |