C16H14ClN3O — CID 117160489
3-(3-chlorophenyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117160489) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(3-chlorophenyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117160489 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-(3-chlorophenyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine |
| SMILES | Clc1cccc(-n2c(C3CCOC3)nc3cccnc32)c1 |
| InChI | InChI=1S/C16H14ClN3O/c17-12-3-1-4-13(9-12)20-15(11-6-8-21-10-11)19-14-5-2-7-18-16(14)20/h1-5,7,9,11H,6,8,10H2 |
| InChIKey | CWEDOKMCHCEKGE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |