C16H16ClN3 — CID 117165988
3-(3-chlorophenyl)-2-(2-methylpropyl)imidazo[4,5-b]pyridine (PubChem CID 117165988) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-(2-methylpropyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(3-chlorophenyl)-2-(2-methylpropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117165988 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-(3-chlorophenyl)-2-(2-methylpropyl)imidazo[4,5-b]pyridine |
| SMILES | CC(C)Cc1nc2cccnc2n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClN3/c1-11(2)9-15-19-14-7-4-8-18-16(14)20(15)13-6-3-5-12(17)10-13/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | RSBUPZLMFIHHPQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |