C24H20N8O2 — CID 71096604
3-[9-(oxan-4-yl)-8-oxo-7-(pyridin-4-ylmethyl)purin-2-yl]benzimidazole-5-carbonitrile (PubChem CID 71096604) has the molecular formula C24H20N8O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is 3-[9-(oxan-4-yl)-8-oxo-7-(pyridin-4-ylmethyl)purin-2-yl]benzimidazole-5-carbonitrile.
| Compound Name | 3-[9-(oxan-4-yl)-8-oxo-7-(pyridin-4-ylmethyl)purin-2-yl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 71096604 |
| Molecular Formula | C24H20N8O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 3-[9-(oxan-4-yl)-8-oxo-7-(pyridin-4-ylmethyl)purin-2-yl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2ncn(-c3ncc4c(n3)n(C3CCOCC3)c(=O)n4Cc3ccncc3)c2c1 |
| InChI | InChI=1S/C24H20N8O2/c25-12-17-1-2-19-20(11-17)31(15-28-19)23-27-13-21-22(29-23)32(18-5-9-34-10-6-18)24(33)30(21)14-16-3-7-26-8-4-16/h1-4,7-8,11,13,15,18H,5-6,9-10,14H2 |
| InChIKey | NIDYTHCMACIRSS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 116.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |