C23H24IN9O2 — CID 143947828
3-[6-[(1-iodopiperidin-4-yl)amino]-9-(oxan-4-yl)-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile (PubChem CID 143947828) has the molecular formula C23H24IN9O2 and a molecular weight of 585.41 g/mol. Its IUPAC name is 3-[6-[(1-iodopiperidin-4-yl)amino]-9-(oxan-4-yl)-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile.
| Compound Name | 3-[6-[(1-iodopiperidin-4-yl)amino]-9-(oxan-4-yl)-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 143947828 |
| Molecular Formula | C23H24IN9O2 |
| Molecular Weight | 585.41 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 3-[6-[(1-iodopiperidin-4-yl)amino]-9-(oxan-4-yl)-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2ncn(-c3nc(NC4CCN(I)CC4)c4[nH]c(=O)n(C5CCOCC5)c4n3)c2c1 |
| InChI | InChI=1S/C23H24IN9O2/c24-31-7-3-15(4-8-31)27-20-19-21(33(23(34)28-19)16-5-9-35-10-6-16)30-22(29-20)32-13-26-17-2-1-14(12-25)11-18(17)32/h1-2,11,13,15-16H,3-10H2,(H,28,34)(H,27,29,30) |
| InChIKey | XTKHHKKHHOGFSC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 129.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|