C25H20FN7O2 — CID 59727033
3-[7-[(3-fluorophenyl)methyl]-9-(oxan-4-yl)-8-oxopurin-2-yl]benzimidazole-5-carbonitrile (PubChem CID 59727033) has the molecular formula C25H20FN7O2 and a molecular weight of 469.48 g/mol. Its IUPAC name is 3-[7-[(3-fluorophenyl)methyl]-9-(oxan-4-yl)-8-oxopurin-2-yl]benzimidazole-5-carbonitrile.
| Compound Name | 3-[7-[(3-fluorophenyl)methyl]-9-(oxan-4-yl)-8-oxopurin-2-yl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 59727033 |
| Molecular Formula | C25H20FN7O2 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 3-[7-[(3-fluorophenyl)methyl]-9-(oxan-4-yl)-8-oxopurin-2-yl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2ncn(-c3ncc4c(n3)n(C3CCOCC3)c(=O)n4Cc3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C25H20FN7O2/c26-18-3-1-2-17(10-18)14-31-22-13-28-24(32-15-29-20-5-4-16(12-27)11-21(20)32)30-23(22)33(25(31)34)19-6-8-35-9-7-19/h1-5,10-11,13,15,19H,6-9,14H2 |
| InChIKey | DBUAEBLCZNWQQC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |