C25H21N7O — CID 24954756
3-[8-(3-methylphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile (PubChem CID 24954756) has the molecular formula C25H21N7O and a molecular weight of 435.49 g/mol. Its IUPAC name is 3-[8-(3-methylphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile.
| Compound Name | 3-[8-(3-methylphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 24954756 |
| Molecular Formula | C25H21N7O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-[8-(3-methylphenyl)-9-(oxan-4-yl)purin-2-yl]benzimidazole-5-carbonitrile |
| SMILES | Cc1cccc(-c2nc3cnc(-n4cnc5ccc(C#N)cc54)nc3n2C2CCOCC2)c1 |
| InChI | InChI=1S/C25H21N7O/c1-16-3-2-4-18(11-16)23-29-21-14-27-25(30-24(21)32(23)19-7-9-33-10-8-19)31-15-28-20-6-5-17(13-26)12-22(20)31/h2-6,11-12,14-15,19H,7-10H2,1H3 |
| InChIKey | MVTJNQQMUTTXTO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |