C22H18FN7O — CID 59704914
2-(6-fluorobenzimidazol-1-yl)-9-(oxan-4-yl)-8-pyridin-4-ylpurine (PubChem CID 59704914) has the molecular formula C22H18FN7O and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-(6-fluorobenzimidazol-1-yl)-9-(oxan-4-yl)-8-pyridin-4-ylpurine.
| Compound Name | 2-(6-fluorobenzimidazol-1-yl)-9-(oxan-4-yl)-8-pyridin-4-ylpurine |
|---|---|
| PubChem CID | 59704914 |
| Molecular Formula | C22H18FN7O |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-(6-fluorobenzimidazol-1-yl)-9-(oxan-4-yl)-8-pyridin-4-ylpurine |
| SMILES | Fc1ccc2ncn(-c3ncc4nc(-c5ccncc5)n(C5CCOCC5)c4n3)c2c1 |
| InChI | InChI=1S/C22H18FN7O/c23-15-1-2-17-19(11-15)29(13-26-17)22-25-12-18-21(28-22)30(16-5-9-31-10-6-16)20(27-18)14-3-7-24-8-4-14/h1-4,7-8,11-13,16H,5-6,9-10H2 |
| InChIKey | VVPLEGKAYUGWLS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |