C19H17FN6O2 — CID 59846584
2-(6-fluorobenzimidazol-1-yl)-9-(8-oxabicyclo[3.2.1]octan-3-yl)-7H-purin-8-one (PubChem CID 59846584) has the molecular formula C19H17FN6O2 and a molecular weight of 380.38 g/mol. Its IUPAC name is 2-(6-fluorobenzimidazol-1-yl)-9-(8-oxabicyclo[3.2.1]octan-3-yl)-7H-purin-8-one.
| Compound Name | 2-(6-fluorobenzimidazol-1-yl)-9-(8-oxabicyclo[3.2.1]octan-3-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 59846584 |
| Molecular Formula | C19H17FN6O2 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-(6-fluorobenzimidazol-1-yl)-9-(8-oxabicyclo[3.2.1]octan-3-yl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-n3cnc4ccc(F)cc43)nc2n1C1CC2CCC(C1)O2 |
| InChI | InChI=1S/C19H17FN6O2/c20-10-1-4-14-16(5-10)25(9-22-14)18-21-8-15-17(24-18)26(19(27)23-15)11-6-12-2-3-13(7-11)28-12/h1,4-5,8-9,11-13H,2-3,6-7H2,(H,23,27) |
| InChIKey | RVZAKRXHGYGQGZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |